25johnca 25johnca

Today at 3:08 PM
History

Answered

Invented by Johannes Gutenberg to produce books quickly

Answer :

Today at 3:13 PM

Answer:

Explanation:

The Printing Press

Answer Link

Other Questions

A population of bacteria is declining at an exponential rate of 5% per day under the impact of a new medical drug. Find the population of bacteria after 20 days

What did Don bring up that made Steve look suspicious? Monsters are due on maple street

Birth defects affect 1 in 32 babies born in a certain country each year. a) What is the probability that a baby born in this country will have a birth defect?

Birth defects affect 1 in 32 babies born in a certain country each year. a) What is the probability that a baby born in this country will have a birth defect?

A dog walking along some train tracks meets a train every 4 minutes and the train catches up the dog every 12 minutes. Find the value of x if the trains leave t

How can a force cause oscillatory motion?

what is the value of experience + 7 divided by 6 divided by 1 divided by 5 - 3 of 12 upon 7

સંધી ની વ્યાખ્યા લખો

prompt- your class monitor is in charge all checking students for proper school uniform and often penolisez them when they are at fault , however you notice tha

The conjugate acid of [tex]\mathrm{CH}3 \mathrm{COO}^{-}[/tex]is

Select the correct proper or common name for the compound.CC(Cl)CC(=O)O The compound is named: 3-chloro-3-methylpropanoate ion 3-chloro-3-methylpropanoate 3-chl

capital budgeting decisions include .

Which one of the following is the strongest acid? How did you get your answer?CCCC(=O)OCCC(C)C(=O)OCCC(=O)OCCC(Cl)C(=O)OCCC(Br)C(=O)O a. 1 b. 2 c. 3 d. 4 e. 5

Classify the following second-order partial differential equations. [tex]1.1 \quad 3 \frac{\partial^2 \phi}{\partial x^2}+\frac{\partial^2 \phi}{\partial x \par

enterotoxins are .

Is [tex]\mathrm{F}2[/tex] a polar or nonpolar molecule and why? Select one: a. F2 is a polar molecule because it has nonbonding electrons. b. F, is a nonpolar m

You have been given palindrome. 5 , a MIPS assembler program that reads a line of input and then prints 2 lines. \$1521 spim -f palindrome, s Enter a line of in

In the Doppler effect it is important to distinguish between? a. frequency and speed. b. speed and velocity. c. speed and acceleration. d. distance and displace

Scientists can use hybridization to detect a specific sequence using a fluorescently or radioactively labeled probe. In the case of FISH,